Products 37603-26-2
CAS 37603-26-2 appears in our catalog under these names: (5-Methoxybenzofuran-2-yl)methanol, 95+%, (5-Methoxy-1-benzofuran-2-yl)methanol. Offered by: AmBeed, TRC. Available pack sizes: 1g, 250mg.
(5-methoxy-1-benzofuran-2-yl)methanol (CAS 37603-26-2) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (5-methoxy-1-benzofuran-2-yl)methanol. InChIKey: ZTGZJYZILIDGMD-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (5-methoxy-1-benzofuran-2-yl)methanol |
| InChIKey | ZTGZJYZILIDGMD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=C2)CO |
Computed by PubChem (NCBI)