CAS 37612-52-5 appears in our catalog under these names: 3-Chloro-4-methoxyacetophenone, 95%, 3'–Chloro–4'–methoxyacetophenone, 3'-Chloro-4'-methoxyacetophenone, 3'-Chloro-4'-methoxyacetophenone, >98.0%(GC), 1-(3-Chloro-4-methoxyphenyl)ethanone 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 100g.
1-(3-chloro-4-methoxyphenyl)ethanone (CAS 37612-52-5) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 1-(3-chloro-4-methoxyphenyl)ethanone. InChIKey: QILWOKAXHOAFOF-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1-(3-chloro-4-methoxyphenyl)ethanone |
| InChIKey | QILWOKAXHOAFOF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)Cl |
Computed by PubChem (NCBI)