CAS 376359-52-3 is the registry number for 5-Chloro-3-methyl-1-(3-(trifluoromethyl)phenyl)-1H-pyrazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde (CAS 376359-52-3) is a chemical compound with the molecular formula C12H8ClF3N2O and a molecular weight of 288.65 g/mol. IUPAC name: 5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde. InChIKey: QVDGMJYLEVIDOK-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF3N2O |
|---|---|
| Molecular weight | 288.65 g/mol |
| IUPAC name | 5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbaldehyde |
| InChIKey | QVDGMJYLEVIDOK-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C=O)Cl)C2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)