CAS 71422-80-5 is the registry number for 4-(3-Chloro-5-(trifluoromethyl)-2-pyridyloxy)phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]aniline (CAS 71422-80-5) is a chemical compound with the molecular formula C12H8ClF3N2O and a molecular weight of 288.65 g/mol. IUPAC name: 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]aniline. InChIKey: NCHHJZDBVKYIDQ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF3N2O |
|---|---|
| Molecular weight | 288.65 g/mol |
| IUPAC name | 4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]aniline |
| InChIKey | NCHHJZDBVKYIDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)