CAS 80783-47-7 appears in our catalog under these names: 3-([3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy)aniline, 95%, 3-{(3-chloro-5-(trifluoromethyl)-2-pyridinyl)oxy}aniline, 3-{[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}aniline, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g.
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]aniline (CAS 80783-47-7) is a chemical compound with the molecular formula C12H8ClF3N2O and a molecular weight of 288.65 g/mol. IUPAC name: 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]aniline. InChIKey: LVMXOVGZNWGJAB-UHFFFAOYSA-N.
| Molecular formula | C12H8ClF3N2O |
|---|---|
| Molecular weight | 288.65 g/mol |
| IUPAC name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]aniline |
| InChIKey | LVMXOVGZNWGJAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl)N |
Computed by PubChem (NCBI)