Products 37672-04-1
CAS 37672-04-1 is the registry number for 2-(Aminomethyl)-4-((7-chloroquinolin-4-yl)amino)phenol. Offered by: Fluorochem. Available pack sizes: 10mg.
2-(aminomethyl)-4-[(7-chloroquinolin-4-yl)amino]phenol (CAS 37672-04-1) is a chemical compound with the molecular formula C16H14ClN3O and a molecular weight of 299.75 g/mol. IUPAC name: 2-(aminomethyl)-4-[(7-chloroquinolin-4-yl)amino]phenol. InChIKey: AVPAYZANVNXCCK-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 2-(aminomethyl)-4-[(7-chloroquinolin-4-yl)amino]phenol |
| InChIKey | AVPAYZANVNXCCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=C3C=CC(=CC3=NC=C2)Cl)CN)O |
Computed by PubChem (NCBI)