CAS 37687-24-4 appears in our catalog under these names: 3,5-Diethyl 1H-pyrazole-3,5-dicarboxylate, >95% (HPLC), Diethyl 3,5–pyrazoledicarboxylate, Diethyl Pyrazole-3,5-dicarboxylate, >98.0%(GC), Diethyl pyrazole-3,5-dicarboxylate, 99%, Diethyl pyrazole-3,5-dicarboxylate 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 100g, 25g, 1g, 5g, 10g.
Diethyl 1H-pyrazole-3,5-dicarboxylate (CAS 37687-24-4) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: diethyl 1H-pyrazole-3,5-dicarboxylate. InChIKey: MBWXLICVQZUJOW-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | diethyl 1H-pyrazole-3,5-dicarboxylate |
| InChIKey | MBWXLICVQZUJOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1)C(=O)OCC |
Computed by PubChem (NCBI)