Products 377059-68-2
CAS 377059-68-2 appears in our catalog under these names: Methyl 3-(3-bromophenyl)-1,2-oxazole-5-carboxylate, Methyl 3-(3-bromophenyl)-1,2-oxazole-5-carboxylate, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 1g, 250mg, 5g.
Methyl 3-(3-bromophenyl)-1,2-oxazole-5-carboxylate (CAS 377059-68-2) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: methyl 3-(3-bromophenyl)-1,2-oxazole-5-carboxylate. InChIKey: ULDKSOMTGPDKLB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | methyl 3-(3-bromophenyl)-1,2-oxazole-5-carboxylate |
| InChIKey | ULDKSOMTGPDKLB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NO1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)