Products 37719-98-5
CAS 37719-98-5 is the registry number for Angelicone. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dimethoxy-8-(3-methylbut-2-enoyl)chromen-2-one (CAS 37719-98-5) is a chemical compound with the molecular formula C16H16O5 and a molecular weight of 288.29 g/mol. IUPAC name: 5,7-dimethoxy-8-(3-methylbut-2-enoyl)chromen-2-one. InChIKey: JEDBBFHVVHKMKS-UHFFFAOYSA-N.
| Molecular formula | C16H16O5 |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | 5,7-dimethoxy-8-(3-methylbut-2-enoyl)chromen-2-one |
| InChIKey | JEDBBFHVVHKMKS-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)C1=C(C=C(C2=C1OC(=O)C=C2)OC)OC)C |
Computed by PubChem (NCBI)