CAS 3772-93-8 is the registry number for β-Bulnesene. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
(3S,3aS)-3,8-dimethyl-5-propan-2-ylidene-2,3,3a,4,6,7-hexahydro-1H-azulene (CAS 3772-93-8) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (3S,3aS)-3,8-dimethyl-5-propan-2-ylidene-2,3,3a,4,6,7-hexahydro-1H-azulene. InChIKey: XUTBNOJXXIWRCB-WFASDCNBSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (3S,3aS)-3,8-dimethyl-5-propan-2-ylidene-2,3,3a,4,6,7-hexahydro-1H-azulene |
| InChIKey | XUTBNOJXXIWRCB-WFASDCNBSA-N |
| SMILES | C[C@H]1CCC2=C(CCC(=C(C)C)C[C@@H]12)C |
Computed by PubChem (NCBI)