CAS 37724-28-0 is the registry number for 1H-1,3-Benzodiazol-7-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
1H-benzimidazol-4-amine;dihydrochloride (CAS 37724-28-0) is a chemical compound with the molecular formula C7H9Cl2N3 and a molecular weight of 206.07 g/mol. IUPAC name: 1H-benzimidazol-4-amine;dihydrochloride. InChIKey: ZEZRFTXFWVHVEL-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 1H-benzimidazol-4-amine;dihydrochloride |
| InChIKey | ZEZRFTXFWVHVEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)