CAS 377772-91-3 appears in our catalog under these names: 1-(4-Bromobenzenesulfonyl)piperidine-3-carboxylic acid, 95%, 1-[(4-Bromophenyl)sulfonyl]piperidine-3-carboxylic acid, 95%, 1-(4-Bromobenzenesulfonyl)piperidine-3-carboxylic acid, 95%, 95%. Offered by: Fluorochem, Ambeed, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-bromophenyl)sulfonylpiperidine-3-carboxylic acid (CAS 377772-91-3) is a chemical compound with the molecular formula C12H14BrNO4S and a molecular weight of 348.21 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonylpiperidine-3-carboxylic acid. InChIKey: RPDNOGDHYBUAKL-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4S |
|---|---|
| Molecular weight | 348.21 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonylpiperidine-3-carboxylic acid |
| InChIKey | RPDNOGDHYBUAKL-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)