Products 58760-59-1
CAS 58760-59-1 is the registry number for 2-Bromo-1-(4-(morpholine-4-sulfonyl)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-bromo-1-(4-morpholin-4-ylsulfonylphenyl)ethanone (CAS 58760-59-1) is a chemical compound with the molecular formula C12H14BrNO4S and a molecular weight of 348.21 g/mol. IUPAC name: 2-bromo-1-(4-morpholin-4-ylsulfonylphenyl)ethanone. InChIKey: AOXMRCRZFSYCQD-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4S |
|---|---|
| Molecular weight | 348.21 g/mol |
| IUPAC name | 2-bromo-1-(4-morpholin-4-ylsulfonylphenyl)ethanone |
| InChIKey | AOXMRCRZFSYCQD-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)