Products 474625-93-9

CAS 474625-93-9 is the registry number for 1-[(4-Bromophenyl)sulfonyl]piperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.

Structural formula: {0} (CAS {1})

1-(4-bromophenyl)sulfonylpiperidine-2-carboxylic acid (CAS 474625-93-9) is a chemical compound with the molecular formula C12H14BrNO4S and a molecular weight of 348.21 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonylpiperidine-2-carboxylic acid. InChIKey: BFYXCFKAZNUOEO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14BrNO4S
Molecular weight348.21 g/mol
IUPAC name1-(4-bromophenyl)sulfonylpiperidine-2-carboxylic acid
InChIKeyBFYXCFKAZNUOEO-UHFFFAOYSA-N
SMILESC1CCN(C(C1)C(=O)O)S(=O)(=O)C2=CC=C(C=C2)Br

Computed by PubChem (NCBI)