CAS 37876-50-9 is the registry number for (±)-beta-Santalene. Offered by: TRC. Available pack sizes: 500mg.
(-)-beta-santalene is a sesquiterpene and carbobicyclic compound that is bicyclo[2.2.1]heptane in which the hydrogens at position 3 are substituted by a methylidene group, while the 2-exo- and 2-endo- hydrogens are subsitituted by 2-methylpent-2-en-5-yl and methyl groups, respectively (the 1S,2R,4R enantiomer). It has a role as a plant metabolite. It is a sesquiterpene, a polycyclic olefin, a bridged compound and a carbobicyclic compound.
Source: ChEBI
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1S,2R,4R)-2-methyl-3-methylidene-2-(4-methylpent-3-enyl)bicyclo[2.2.1]heptane |
| InChIKey | PGBNIHXXFQBCPU-ILXRZTDVSA-N |
| SMILES | CC(=CCC[C@@]1([C@H]2CC[C@H](C2)C1=C)C)C |
Computed by PubChem (NCBI)