CAS 379223-64-0 appears in our catalog under these names: 3-(3,4-Dimethoxyphenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 3-(3,4-Dimethoxyphenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 97%, 97%, 3-(3,4-Dimethoxyphenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 379223-64-0) is a chemical compound with the molecular formula C18H16N2O4 and a molecular weight of 324.3 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: TZYXKOWJIFWEAS-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O4 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | TZYXKOWJIFWEAS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)