CAS 4790-22-1 appears in our catalog under these names: 5-Methoxy-Alpha-oxo-6-(phenylmethoxy)-1H-indole-3-acetamide, 5-Methoxy-a-oxo-6-(phenylmethoxy)-1H-indole-3-acetamide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-(5-methoxy-6-phenylmethoxy-1H-indol-3-yl)-2-oxoacetamide (CAS 4790-22-1) is a chemical compound with the molecular formula C18H16N2O4 and a molecular weight of 324.3 g/mol. IUPAC name: 2-(5-methoxy-6-phenylmethoxy-1H-indol-3-yl)-2-oxoacetamide. InChIKey: PCHDFDYTZSWGFR-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O4 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 2-(5-methoxy-6-phenylmethoxy-1H-indol-3-yl)-2-oxoacetamide |
| InChIKey | PCHDFDYTZSWGFR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CN2)C(=O)C(=O)N)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)