Products 956386-16-6
CAS 956386-16-6 is the registry number for 3-(2,5-Dimethoxyphenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 956386-16-6) is a chemical compound with the molecular formula C18H16N2O4 and a molecular weight of 324.3 g/mol. IUPAC name: 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: XXPRPKAYBHGUQB-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O4 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | XXPRPKAYBHGUQB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=NN(C=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)