Products 379254-57-6
CAS 379254-57-6 appears in our catalog under these names: 4-Chloro-3-[(thiophene-2-carbonyl)-amino]-benzoic acid, 95%, 4-Chloro-3-(thiophene-2-carboxamido)benzoic acid, 97%, 4-Chloro-3-(thiophene-2-amido)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
4-chloro-3-(thiophene-2-carbonylamino)benzoic acid (CAS 379254-57-6) is a chemical compound with the molecular formula C12H8ClNO3S and a molecular weight of 281.72 g/mol. IUPAC name: 4-chloro-3-(thiophene-2-carbonylamino)benzoic acid. InChIKey: IZVSYFRATKXUQC-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3S |
|---|---|
| Molecular weight | 281.72 g/mol |
| IUPAC name | 4-chloro-3-(thiophene-2-carbonylamino)benzoic acid |
| InChIKey | IZVSYFRATKXUQC-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NC2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)