CAS 439111-81-6 is the registry number for 3-(2-Chlorobenzamido)thiophene-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(2-chlorobenzoyl)amino]thiophene-2-carboxylic acid (CAS 439111-81-6) is a chemical compound with the molecular formula C12H8ClNO3S and a molecular weight of 281.72 g/mol. IUPAC name: 3-[(2-chlorobenzoyl)amino]thiophene-2-carboxylic acid. InChIKey: DFOQJQLRPKSGPU-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3S |
|---|---|
| Molecular weight | 281.72 g/mol |
| IUPAC name | 3-[(2-chlorobenzoyl)amino]thiophene-2-carboxylic acid |
| InChIKey | DFOQJQLRPKSGPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(SC=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)