Products 830340-41-5

CAS 830340-41-5 is the registry number for 3-(5-Chlorothiophene-2-carboxamido)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(5-chlorothiophene-2-carbonyl)amino]benzoic acid (CAS 830340-41-5) is a chemical compound with the molecular formula C12H8ClNO3S and a molecular weight of 281.72 g/mol. IUPAC name: 3-[(5-chlorothiophene-2-carbonyl)amino]benzoic acid. InChIKey: HMRRHFQEXVYJIY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8ClNO3S
Molecular weight281.72 g/mol
IUPAC name3-[(5-chlorothiophene-2-carbonyl)amino]benzoic acid
InChIKeyHMRRHFQEXVYJIY-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)NC(=O)C2=CC=C(S2)Cl)C(=O)O

Computed by PubChem (NCBI)