Products 37953-05-2
CAS 37953-05-2 is the registry number for Benzenesulfonic Acid Impurity 4. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-(Propan-2-yl)benzenesulfonic acid is an organosulfur compound and a sulfonic acid derivative.
Source: ChEBI
| Molecular formula | C9H12O3S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-propan-2-ylbenzenesulfonic acid |
| InChIKey | CVLHGLWXLDOELD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-isopropylbenzenesulfonic acid, p-cumenesulfonic acid, Benzenesulfonic acid, 4-(1-methylethyl)-, p-Cumenesulphonic acid, 4-propan-2-ylbenzenesulfonic acid, 4-(Propan-2-Yl)Benzene-1-Sulfonic Acid, p-isopropylbenzene sulfonic acid, 4-(Propan-2-yl)benzenesulfonic acid, 4-Cumenesulfonic acid, 2(Or 4)-(isopropyl)benzenesulphonic acid