CAS 3800-06-4 appears in our catalog under these names: 2-Amino-4'-fluorobenzophenone 95%, 2-Amino-4'-fluorobenzophenone, >95% (HPLC), 2-Amino-4'-fluorobenzophenone, 98%, 98%, 2-Amino-4'-fluorobenzophenone, >98.0%(GC)(T). Offered by: Ambeed, TRC, Chemat, TCI. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
(2-aminophenyl)-(4-fluorophenyl)methanone (CAS 3800-06-4) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: (2-aminophenyl)-(4-fluorophenyl)methanone. InChIKey: FFFXIQFESQNINT-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | (2-aminophenyl)-(4-fluorophenyl)methanone |
| InChIKey | FFFXIQFESQNINT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)