CAS 38002-89-0 appears in our catalog under these names: (2,2-Dimethyl-2,3-dihydrobenzofuran-7-yl)methanol, 97%, (2,2–Dimethyl–2,3–dihydrobenzofuran–7–yl)methanol. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 1g, 250mg.
(2,2-dimethyl-3H-1-benzofuran-7-yl)methanol (CAS 38002-89-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: (2,2-dimethyl-3H-1-benzofuran-7-yl)methanol. InChIKey: LKFXMRFTJVYQMT-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | (2,2-dimethyl-3H-1-benzofuran-7-yl)methanol |
| InChIKey | LKFXMRFTJVYQMT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)CO)C |
Computed by PubChem (NCBI)