Products 380332-19-4
CAS 380332-19-4 is the registry number for 1-(6-Methoxy-3-pyridyl)-3-(4-nitrophenyl)urea, ≥95%. Offered by: Chemat. Available pack sizes: 10mg.
1-(6-methoxy-3-pyridinyl)-3-(4-nitrophenyl)urea (CAS 380332-19-4) is a chemical compound with the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. IUPAC name: 1-(6-methoxy-3-pyridinyl)-3-(4-nitrophenyl)urea. InChIKey: VEQOEIFRJLOMNJ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O4 |
|---|---|
| Molecular weight | 288.26 g/mol |
| IUPAC name | 1-(6-methoxy-3-pyridinyl)-3-(4-nitrophenyl)urea |
| InChIKey | VEQOEIFRJLOMNJ-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)NC(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)