Products 380349-08-6
CAS 380349-08-6 appears in our catalog under these names: 3-Amino-n-(4-bromo-phenyl)-benzenesulfonamide, 95%, 3-Amino-N-(4-bromophenyl)benzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-amino-N-(4-bromophenyl)benzenesulfonamide (CAS 380349-08-6) is a chemical compound with the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. IUPAC name: 3-amino-N-(4-bromophenyl)benzenesulfonamide. InChIKey: ZYTCICJMXGACNY-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2S |
|---|---|
| Molecular weight | 327.20 g/mol |
| IUPAC name | 3-amino-N-(4-bromophenyl)benzenesulfonamide |
| InChIKey | ZYTCICJMXGACNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)