Products 834885-05-1
CAS 834885-05-1 is the registry number for Ethyl 2-amino-4-(4-bromophenyl)thiazole-5-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate (CAS 834885-05-1) is a chemical compound with the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. IUPAC name: ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate. InChIKey: HZNNHEOEYQXAAE-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2O2S |
|---|---|
| Molecular weight | 327.20 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-bromophenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | HZNNHEOEYQXAAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)