Products 430464-20-3
CAS 430464-20-3 is the registry number for (5Z)-5-(2-Bromo-5-ethoxybenzylidene)-2-imino-1,3-thiazolidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(5Z)-5-[(2-bromo-5-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (CAS 430464-20-3) is a chemical compound with the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. IUPAC name: (5Z)-5-[(2-bromo-5-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one. InChIKey: RYHFNPZVJJOWFP-POHAHGRESA-N.
| Molecular formula | C12H11BrN2O2S |
|---|---|
| Molecular weight | 327.20 g/mol |
| IUPAC name | (5Z)-5-[(2-bromo-5-ethoxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| InChIKey | RYHFNPZVJJOWFP-POHAHGRESA-N |
| SMILES | CCOC1=CC(=C(C=C1)Br)/C=C\2/C(=O)NC(=N)S2 |
Computed by PubChem (NCBI)