CAS 380442-86-4 appears in our catalog under these names: 2-((2,6-Dimethylphenyl)imino)-1,3-thiazolidin-4-one, 2-[(2,6-Dimethylphenyl)imino]-1,3-thiazolidin-4-one, 95%, 2-((2,6-Dimethylphenyl)imino)-1,3-thiazolidin-4-one, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one (CAS 380442-86-4) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one. InChIKey: FBQWEQNQNVYRKS-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 2-(2,6-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| InChIKey | FBQWEQNQNVYRKS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N=C2NC(=O)CS2 |
Computed by PubChem (NCBI)