CAS 380643-54-9 is the registry number for 2–(2–(4–ethoxyphenyl)vinyl)–4H–1,3–benzoxazin–4–one. Offered by: GLPBio. Available pack sizes: 5mg.
2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1,3-benzoxazin-4-one (CAS 380643-54-9) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1,3-benzoxazin-4-one. InChIKey: CCLAOBVTVUUPGH-FMIVXFBMSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 2-[(E)-2-(4-ethoxyphenyl)ethenyl]-1,3-benzoxazin-4-one |
| InChIKey | CCLAOBVTVUUPGH-FMIVXFBMSA-N |
| SMILES | CCOC1=CC=C(C=C1)/C=C/C2=NC(=O)C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)