Products 3807-56-5
CAS 3807-56-5 appears in our catalog under these names: 2,5-Dimethyl-1-phenyl-1h-pyrrole-3-carboxylic acid, 95%, 2，5-Dimethyl-1-phenyl-1H-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2,5-dimethyl-1-phenylpyrrole-3-carboxylic acid (CAS 3807-56-5) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2,5-dimethyl-1-phenylpyrrole-3-carboxylic acid. InChIKey: CIRVCSCFJALBOH-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2,5-dimethyl-1-phenylpyrrole-3-carboxylic acid |
| InChIKey | CIRVCSCFJALBOH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2)C)C(=O)O |
Computed by PubChem (NCBI)