CAS 38076-76-5 appears in our catalog under these names: 6-Chloro-2-hydroxynicotinic acid 95%, 6-Chloro-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid, 98%+, 98%+, 6-Chloro-2-hydroxynicotinic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
6-chloro-2-oxo-1H-pyridine-3-carboxylic acid (CAS 38076-76-5) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 6-chloro-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: HLXITPCEBVXBDJ-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 6-chloro-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | HLXITPCEBVXBDJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)