Products 380906-80-9

CAS 380906-80-9 appears in our catalog under these names: 5-(2,5-Dichlorophenyl)furan-2-carbonyl chloride, 95%, 5-(2,5-Dichlorophenyl)furan-2-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(2,5-dichlorophenyl)furan-2-carbonyl chloride (CAS 380906-80-9) is a chemical compound with the molecular formula C11H5Cl3O2 and a molecular weight of 275.5 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)furan-2-carbonyl chloride. InChIKey: BSRRSYCAENNRPG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H5Cl3O2
Molecular weight275.5 g/mol
IUPAC name5-(2,5-dichlorophenyl)furan-2-carbonyl chloride
InChIKeyBSRRSYCAENNRPG-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C2=CC=C(O2)C(=O)Cl)Cl

Computed by PubChem (NCBI)