CAS 380906-80-9 appears in our catalog under these names: 5-(2,5-Dichlorophenyl)furan-2-carbonyl chloride, 95%, 5-(2,5-Dichlorophenyl)furan-2-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(2,5-dichlorophenyl)furan-2-carbonyl chloride (CAS 380906-80-9) is a chemical compound with the molecular formula C11H5Cl3O2 and a molecular weight of 275.5 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)furan-2-carbonyl chloride. InChIKey: BSRRSYCAENNRPG-UHFFFAOYSA-N.
| Molecular formula | C11H5Cl3O2 |
|---|---|
| Molecular weight | 275.5 g/mol |
| IUPAC name | 5-(2,5-dichlorophenyl)furan-2-carbonyl chloride |
| InChIKey | BSRRSYCAENNRPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC=C(O2)C(=O)Cl)Cl |
Computed by PubChem (NCBI)