Products 61941-91-1

CAS 61941-91-1 is the registry number for 5-(3,4-Dichloro-phenyl)-furan-2-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(3,4-dichlorophenyl)furan-2-carbonyl chloride (CAS 61941-91-1) is a chemical compound with the molecular formula C11H5Cl3O2 and a molecular weight of 275.5 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)furan-2-carbonyl chloride. InChIKey: XQRLANCABKJNFO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H5Cl3O2
Molecular weight275.5 g/mol
IUPAC name5-(3,4-dichlorophenyl)furan-2-carbonyl chloride
InChIKeyXQRLANCABKJNFO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC=C(O2)C(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)