CAS 68502-15-8 is the registry number for 5-(2,4,5-Trichlorophenyl)furan-2-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,4,5-trichlorophenyl)furan-2-carbaldehyde (CAS 68502-15-8) is a chemical compound with the molecular formula C11H5Cl3O2 and a molecular weight of 275.5 g/mol. IUPAC name: 5-(2,4,5-trichlorophenyl)furan-2-carbaldehyde. InChIKey: CYFLYDRJZXHEGS-UHFFFAOYSA-N.
| Molecular formula | C11H5Cl3O2 |
|---|---|
| Molecular weight | 275.5 g/mol |
| IUPAC name | 5-(2,4,5-trichlorophenyl)furan-2-carbaldehyde |
| InChIKey | CYFLYDRJZXHEGS-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C2=CC(=C(C=C2Cl)Cl)Cl)C=O |
Computed by PubChem (NCBI)