CAS 38093-76-4 is the registry number for 2-Methyl-4-phenyl-1,3-thiazol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-4-phenyl-1,3-thiazol-5-amine (CAS 38093-76-4) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 2-methyl-4-phenyl-1,3-thiazol-5-amine. InChIKey: BSPLETCHADLYRW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 2-methyl-4-phenyl-1,3-thiazol-5-amine |
| InChIKey | BSPLETCHADLYRW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)