Products 38127-65-0
CAS 38127-65-0 is the registry number for 3-(4-methoxyphenyl)-1,6,6-trimethyl-5,6,7-trihydro1H-indazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-methoxyphenyl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one (CAS 38127-65-0) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: 3-(4-methoxyphenyl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one. InChIKey: JROPLWXCCOUZSF-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O2 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-1,6,6-trimethyl-5,7-dihydroindazol-4-one |
| InChIKey | JROPLWXCCOUZSF-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)C(=NN2C)C3=CC=C(C=C3)OC)C |
Computed by PubChem (NCBI)