CAS 383127-68-2 appears in our catalog under these names: 2-(4-Bromobenzyl)pyrrolidine, 95+%, 2-(4-Bromo-benzyl)-pyrrolidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 25mg, 50mg, 100mg, 250mg, 500mg.
2-[(4-bromophenyl)methyl]pyrrolidine (CAS 383127-68-2) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]pyrrolidine. InChIKey: PRNKZLSWJHKYQX-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]pyrrolidine |
| InChIKey | PRNKZLSWJHKYQX-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)