CAS 383130-81-2 is the registry number for 2-(3,4-Dichlorophenyl)azepane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)azepane (CAS 383130-81-2) is a chemical compound with the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)azepane. InChIKey: GCJBQLBLGXVIAK-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)azepane |
| InChIKey | GCJBQLBLGXVIAK-UHFFFAOYSA-N |
| SMILES | C1CCC(NCC1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)