Products 383133-18-4

CAS 383133-18-4 is the registry number for 4,6,7-Trimethyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4,6,7-trimethyl-1H-indole-2-carboxylic acid (CAS 383133-18-4) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 4,6,7-trimethyl-1H-indole-2-carboxylic acid. InChIKey: CDZKEBOPHBEZGX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO2
Molecular weight203.24 g/mol
IUPAC name4,6,7-trimethyl-1H-indole-2-carboxylic acid
InChIKeyCDZKEBOPHBEZGX-UHFFFAOYSA-N
SMILESCC1=CC(=C2C=C(NC2=C1C)C(=O)O)C

Computed by PubChem (NCBI)