CAS 383133-18-4 is the registry number for 4,6,7-Trimethyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4,6,7-trimethyl-1H-indole-2-carboxylic acid (CAS 383133-18-4) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 4,6,7-trimethyl-1H-indole-2-carboxylic acid. InChIKey: CDZKEBOPHBEZGX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4,6,7-trimethyl-1H-indole-2-carboxylic acid |
| InChIKey | CDZKEBOPHBEZGX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(NC2=C1C)C(=O)O)C |
Computed by PubChem (NCBI)