CAS 383185-76-0 appears in our catalog under these names: tert–Butyl 3–cyanobenzoate, tert-Butyl 3-cyanobenzoate, tert-Butyl 3-cyanobenzoate, 95%, 95%, TERT-BUTYL 3-CYANOBENZOATE, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 25g, 250mg.
Tert-butyl 3-cyanobenzoate (CAS 383185-76-0) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl 3-cyanobenzoate. InChIKey: ASCIDWNCPZKTCI-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl 3-cyanobenzoate |
| InChIKey | ASCIDWNCPZKTCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)