CAS 38346-47-3 is the registry number for Imidazo[1,2-a]quinoxalin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Imidazo[1,2-a]quinoxalin-4-amine (CAS 38346-47-3) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: imidazo[1,2-a]quinoxalin-4-amine. InChIKey: RIEGODVWDDKNBT-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | imidazo[1,2-a]quinoxalin-4-amine |
| InChIKey | RIEGODVWDDKNBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C3=NC=CN23)N |
Computed by PubChem (NCBI)