Products 383671-84-9
CAS 383671-84-9 appears in our catalog under these names: 2–(4–methoxy–3–nitrophenyl)–2–methylpropanoic acid, 2-(4-methoxy-3-nitrophenyl)-2-methylpropanoic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g, 100mg.
2-(4-methoxy-3-nitrophenyl)-2-methylpropanoic acid (CAS 383671-84-9) is a chemical compound with the molecular formula C11H13NO5 and a molecular weight of 239.22 g/mol. IUPAC name: 2-(4-methoxy-3-nitrophenyl)-2-methylpropanoic acid. InChIKey: BDDQJMLSJAYAFP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 2-(4-methoxy-3-nitrophenyl)-2-methylpropanoic acid |
| InChIKey | BDDQJMLSJAYAFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)OC)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)