CAS 38417-65-1 appears in our catalog under these names: 5-((Oxiran-2-yl)methoxy)-2H-1,3-benzodioxole, 95%, 5-((Oxiran-2-yl)methoxy)-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(oxiran-2-ylmethoxy)-1,3-benzodioxole (CAS 38417-65-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 5-(oxiran-2-ylmethoxy)-1,3-benzodioxole. InChIKey: YETPZTCSSANWOG-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 5-(oxiran-2-ylmethoxy)-1,3-benzodioxole |
| InChIKey | YETPZTCSSANWOG-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)