CAS 38470-19-8 is the registry number for N-(2-Fluorophenyl)-3-aminopropionic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 100g, 25g, 10g, 1g.
3-(2-fluoroanilino)propanoic acid (CAS 38470-19-8) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 3-(2-fluoroanilino)propanoic acid. InChIKey: DSLJQEDRQRYPQD-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 3-(2-fluoroanilino)propanoic acid |
| InChIKey | DSLJQEDRQRYPQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NCCC(=O)O)F |
Computed by PubChem (NCBI)