Products 3848-45-1
CAS 3848-45-1 is the registry number for 4-Nitrophenyl diethylcarbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4-nitrophenyl) N,N-diethylcarbamate (CAS 3848-45-1) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: (4-nitrophenyl) N,N-diethylcarbamate. InChIKey: UTZKBUVTKANYLK-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (4-nitrophenyl) N,N-diethylcarbamate |
| InChIKey | UTZKBUVTKANYLK-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)