CAS 38512-82-2 appears in our catalog under these names: 5–methyl–2–nitroanisole, 5-Methyl-2-nitroanisole, 98%, 2-Methoxy-4-methyl-1-nitrobenzene 98%, 2-Methoxy-4-methyl-1-nitrobenzene, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 500g.
2-methoxy-4-methyl-1-nitrobenzene (CAS 38512-82-2) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-methoxy-4-methyl-1-nitrobenzene. InChIKey: XCOUVPWGTSKINY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-methoxy-4-methyl-1-nitrobenzene |
| InChIKey | XCOUVPWGTSKINY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)