Products 3856-05-1
CAS 3856-05-1 appears in our catalog under these names: Gallic Acid Isobutyl Ester, Isobutyl Gallate, >98.0%(HPLC)(T), Isobutyl 3,4,5-trihydroxybenzoate 97%, Isobutyl Gallate, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
2-methylpropyl 3,4,5-trihydroxybenzoate (CAS 3856-05-1) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 2-methylpropyl 3,4,5-trihydroxybenzoate. InChIKey: UCLHVCFKZSLALE-UHFFFAOYSA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-methylpropyl 3,4,5-trihydroxybenzoate |
| InChIKey | UCLHVCFKZSLALE-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC(=C(C(=C1)O)O)O |
Computed by PubChem (NCBI)