CAS 3856-25-5 appears in our catalog under these names: α–Copaene, alfa-Copaene, Alpha-Copaene, Alpha-Copaene (>90%), α-Copaene. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 25mg, 5mg, on request, 10mg, 1mg, 2mg, 1 mg.
(1R,2S,6S,7S,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene (CAS 3856-25-5) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1R,2S,6S,7S,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene. InChIKey: VLXDPFLIRFYIME-BTFPBAQTSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,2S,6S,7S,8S)-1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene |
| InChIKey | VLXDPFLIRFYIME-BTFPBAQTSA-N |
| SMILES | CC1=CC[C@H]2[C@H]3[C@@H]1[C@@]2(CC[C@H]3C(C)C)C |
Computed by PubChem (NCBI)