Products 385820-18-8
CAS 385820-18-8 is the registry number for (αS,2S)-1-[(1,1-Dimethylethoxy)carbonyl]-α-methyl-2-pyrrolidineacetic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(2S)-2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid (CAS 385820-18-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid. InChIKey: IYTMSLGCCACZRJ-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]propanoic acid |
| InChIKey | IYTMSLGCCACZRJ-IUCAKERBSA-N |
| SMILES | C[C@@H]([C@@H]1CCCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)